C20H25NO5S — CID 4283471
[4-[[butyl-(3-methoxybenzoyl)amino]methyl]phenyl] methanesulfonate (PubChem CID 4283471) has the molecular formula C20H25NO5S and a molecular weight of 391.49 g/mol. Its IUPAC name is [4-[[butyl-(3-methoxybenzoyl)amino]methyl]phenyl] methanesulfonate.
| Compound Name | [4-[[butyl-(3-methoxybenzoyl)amino]methyl]phenyl] methanesulfonate |
|---|---|
| PubChem CID | 4283471 |
| Molecular Formula | C20H25NO5S |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | [4-[[butyl-(3-methoxybenzoyl)amino]methyl]phenyl] methanesulfonate |
| SMILES | CCCCN(Cc1ccc(OS(C)(=O)=O)cc1)C(=O)c1cccc(OC)c1 |
| InChI | InChI=1S/C20H25NO5S/c1-4-5-13-21(20(22)17-7-6-8-19(14-17)25-2)15-16-9-11-18(12-10-16)26-27(3,23)24/h6-12,14H,4-5,13,15H2,1-3H3 |
| InChIKey | ZCGYGFDLUXREND-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|