C24H32FNO4S — CID 46110972
[4-[[(4-fluorophenyl)methyl-octanoylamino]methyl]phenyl] ethanesulfonate (PubChem CID 46110972) has the molecular formula C24H32FNO4S and a molecular weight of 449.59 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)methyl-octanoylamino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)methyl-octanoylamino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 46110972 |
| Molecular Formula | C24H32FNO4S |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | [4-[[(4-fluorophenyl)methyl-octanoylamino]methyl]phenyl] ethanesulfonate |
| SMILES | CCCCCCCC(=O)N(Cc1ccc(F)cc1)Cc1ccc(OS(=O)(=O)CC)cc1 |
| InChI | InChI=1S/C24H32FNO4S/c1-3-5-6-7-8-9-24(27)26(18-20-10-14-22(25)15-11-20)19-21-12-16-23(17-13-21)30-31(28,29)4-2/h10-17H,3-9,18-19H2,1-2H3 |
| InChIKey | UMCXXWZUXHLONC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|