C25H35FN2O3 — CID 4118080
N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-propylheptanamide (PubChem CID 4118080) has the molecular formula C25H35FN2O3 and a molecular weight of 430.56 g/mol. Its IUPAC name is N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-propylheptanamide.
| Compound Name | N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-propylheptanamide |
|---|---|
| PubChem CID | 4118080 |
| Molecular Formula | C25H35FN2O3 |
| Molecular Weight | 430.56 g/mol |
| Exact Mass | 430.26 |
| IUPAC Name | N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-propylheptanamide |
| SMILES | CCCCCCC(=O)N(CCC)CC(=O)N(Cc1ccc(F)cc1)Cc1ccc(C)o1 |
| InChI | InChI=1S/C25H35FN2O3/c1-4-6-7-8-9-24(29)27(16-5-2)19-25(30)28(18-23-15-10-20(3)31-23)17-21-11-13-22(26)14-12-21/h10-15H,4-9,16-19H2,1-3H3 |
| InChIKey | PUXVIBIQAINKNE-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.56 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|