C25H36FN3O3 — CID 42793784
6-amino-N-tert-butyl-N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]hexanamide (PubChem CID 42793784) has the molecular formula C25H36FN3O3 and a molecular weight of 445.58 g/mol. Its IUPAC name is 6-amino-N-tert-butyl-N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]hexanamide.
| Compound Name | 6-amino-N-tert-butyl-N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]hexanamide |
|---|---|
| PubChem CID | 42793784 |
| Molecular Formula | C25H36FN3O3 |
| Molecular Weight | 445.58 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 6-amino-N-tert-butyl-N-[2-[(4-fluorophenyl)methyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]hexanamide |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)C(=O)CN(C(=O)CCCCCN)C(C)(C)C)o1 |
| InChI | InChI=1S/C25H36FN3O3/c1-19-9-14-22(32-19)17-28(16-20-10-12-21(26)13-11-20)24(31)18-29(25(2,3)4)23(30)8-6-5-7-15-27/h9-14H,5-8,15-18,27H2,1-4H3 |
| InChIKey | RQSDDJLBFWWJBV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.58 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|