C26H36N2O3 — CID 3882073
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyloctanamide (PubChem CID 3882073) has the molecular formula C26H36N2O3 and a molecular weight of 424.59 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyloctanamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyloctanamide |
|---|---|
| PubChem CID | 3882073 |
| Molecular Formula | C26H36N2O3 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.27 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-cyclopropyloctanamide |
| SMILES | CCCCCCCC(=O)N(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C1CC1 |
| InChI | InChI=1S/C26H36N2O3/c1-3-4-5-6-10-13-25(29)28(23-15-16-23)20-26(30)27(18-22-11-8-7-9-12-22)19-24-17-14-21(2)31-24/h7-9,11-12,14,17,23H,3-6,10,13,15-16,18-20H2,1-2H3 |
| InChIKey | GGPAULFAGAGJHT-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|