C28H42N2O3 — CID 42773042
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide (PubChem CID 42773042) has the molecular formula C28H42N2O3 and a molecular weight of 454.66 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide |
|---|---|
| PubChem CID | 42773042 |
| Molecular Formula | C28H42N2O3 |
| Molecular Weight | 454.66 g/mol |
| Exact Mass | 454.32 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(2-methylpropyl)nonanamide |
| SMILES | CCCCCCCCC(=O)N(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)CC(C)C |
| InChI | InChI=1S/C28H42N2O3/c1-5-6-7-8-9-13-16-27(31)29(19-23(2)3)22-28(32)30(20-25-14-11-10-12-15-25)21-26-18-17-24(4)33-26/h10-12,14-15,17-18,23H,5-9,13,16,19-22H2,1-4H3 |
| InChIKey | OEEZSAQZWDZCJZ-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.66 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|