C25H26FNO4S — CID 46110983
[4-[[(4-fluorophenyl)methyl-(3-phenylpropanoyl)amino]methyl]phenyl] ethanesulfonate (PubChem CID 46110983) has the molecular formula C25H26FNO4S and a molecular weight of 455.55 g/mol. Its IUPAC name is [4-[[(4-fluorophenyl)methyl-(3-phenylpropanoyl)amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[(4-fluorophenyl)methyl-(3-phenylpropanoyl)amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 46110983 |
| Molecular Formula | C25H26FNO4S |
| Molecular Weight | 455.55 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | [4-[[(4-fluorophenyl)methyl-(3-phenylpropanoyl)amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(Cc2ccc(F)cc2)C(=O)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H26FNO4S/c1-2-32(29,30)31-24-15-10-22(11-16-24)19-27(18-21-8-13-23(26)14-9-21)25(28)17-12-20-6-4-3-5-7-20/h3-11,13-16H,2,12,17-19H2,1H3 |
| InChIKey | XGEBIXGRDXGJMO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.55 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|