C24H26FNO5S — CID 5032192
[4-[[furan-2-ylmethyl(hexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 5032192) has the molecular formula C24H26FNO5S and a molecular weight of 459.54 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl(hexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl(hexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 5032192 |
| Molecular Formula | C24H26FNO5S |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | [4-[[furan-2-ylmethyl(hexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CCCCCC(=O)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)Cc1ccco1 |
| InChI | InChI=1S/C24H26FNO5S/c1-2-3-4-7-24(27)26(18-22-6-5-16-30-22)17-19-8-12-21(13-9-19)31-32(28,29)23-14-10-20(25)11-15-23/h5-6,8-16H,2-4,7,17-18H2,1H3 |
| InChIKey | PBTYGQYFWUMLSE-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|