C27H32FNO5S — CID 3419767
[4-[[furan-2-ylmethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 3419767) has the molecular formula C27H32FNO5S and a molecular weight of 501.62 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 3419767 |
| Molecular Formula | C27H32FNO5S |
| Molecular Weight | 501.62 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | [4-[[furan-2-ylmethyl(3,5,5-trimethylhexanoyl)amino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | CC(CC(=O)N(Cc1ccc(OS(=O)(=O)c2ccc(F)cc2)cc1)Cc1ccco1)CC(C)(C)C |
| InChI | InChI=1S/C27H32FNO5S/c1-20(17-27(2,3)4)16-26(30)29(19-24-6-5-15-33-24)18-21-7-11-23(12-8-21)34-35(31,32)25-13-9-22(28)10-14-25/h5-15,20H,16-19H2,1-4H3 |
| InChIKey | AKNGWWLPPGUJAG-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.62 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|