C23H33NO5S — CID 93110683
[4-[[furan-2-ylmethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] ethanesulfonate (PubChem CID 93110683) has the molecular formula C23H33NO5S and a molecular weight of 435.59 g/mol. Its IUPAC name is [4-[[furan-2-ylmethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] ethanesulfonate.
| Compound Name | [4-[[furan-2-ylmethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] ethanesulfonate |
|---|---|
| PubChem CID | 93110683 |
| Molecular Formula | C23H33NO5S |
| Molecular Weight | 435.59 g/mol |
| Exact Mass | 435.21 |
| IUPAC Name | [4-[[furan-2-ylmethyl-[(3R)-3,5,5-trimethylhexanoyl]amino]methyl]phenyl] ethanesulfonate |
| SMILES | CCS(=O)(=O)Oc1ccc(CN(Cc2ccco2)C(=O)C[C@H](C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C23H33NO5S/c1-6-30(26,27)29-20-11-9-19(10-12-20)16-24(17-21-8-7-13-28-21)22(25)14-18(2)15-23(3,4)5/h7-13,18H,6,14-17H2,1-5H3/t18-/m0/s1 |
| InChIKey | XYCRMCOGXMQEIR-SFHVURJKSA-N |
| XLogP | 5.00 |
| TPSA | 76.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.59 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|