C29H35NO7S — CID 71955252
butyl 2-[4-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71955252) has the molecular formula C29H35NO7S and a molecular weight of 541.67 g/mol. Its IUPAC name is butyl 2-[4-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | butyl 2-[4-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71955252 |
| Molecular Formula | C29H35NO7S |
| Molecular Weight | 541.67 g/mol |
| Exact Mass | 541.21 |
| IUPAC Name | butyl 2-[4-[[3,3-dimethylbutanoyl(furan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CCCCOC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(Cc2ccco2)C(=O)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C29H35NO7S/c1-5-6-17-36-28(32)25-11-7-8-12-26(25)38(33,34)37-23-15-13-22(14-16-23)20-30(21-24-10-9-18-35-24)27(31)19-29(2,3)4/h7-16,18H,5-6,17,19-21H2,1-4H3 |
| InChIKey | UEBVWLGJMRVGSU-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 103.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.67 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|