C25H33NO6S — CID 71955083
butyl 2-[4-[[2-methylpropanoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71955083) has the molecular formula C25H33NO6S and a molecular weight of 475.61 g/mol. Its IUPAC name is butyl 2-[4-[[2-methylpropanoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | butyl 2-[4-[[2-methylpropanoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71955083 |
| Molecular Formula | C25H33NO6S |
| Molecular Weight | 475.61 g/mol |
| Exact Mass | 475.20 |
| IUPAC Name | butyl 2-[4-[[2-methylpropanoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CCCCOC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(C(=O)C(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H33NO6S/c1-6-7-16-31-25(28)22-10-8-9-11-23(22)33(29,30)32-21-14-12-20(13-15-21)17-26(19(4)5)24(27)18(2)3/h8-15,18-19H,6-7,16-17H2,1-5H3 |
| InChIKey | MZOXKPONMNNLKL-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.61 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|