C25H34N2O6S — CID 71954823
propan-2-yl 2-[4-[[tert-butylcarbamoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71954823) has the molecular formula C25H34N2O6S and a molecular weight of 490.62 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[tert-butylcarbamoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | propan-2-yl 2-[4-[[tert-butylcarbamoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71954823 |
| Molecular Formula | C25H34N2O6S |
| Molecular Weight | 490.62 g/mol |
| Exact Mass | 490.21 |
| IUPAC Name | propan-2-yl 2-[4-[[tert-butylcarbamoyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CC(C)OC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(C(=O)NC(C)(C)C)C(C)C)cc1 |
| InChI | InChI=1S/C25H34N2O6S/c1-17(2)27(24(29)26-25(5,6)7)16-19-12-14-20(15-13-19)33-34(30,31)22-11-9-8-10-21(22)23(28)32-18(3)4/h8-15,17-18H,16H2,1-7H3,(H,26,29) |
| InChIKey | UDXLGLDYVNBLFE-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.62 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|