C25H31NO6S — CID 71955724
propan-2-yl 2-[4-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71955724) has the molecular formula C25H31NO6S and a molecular weight of 473.59 g/mol. Its IUPAC name is propan-2-yl 2-[4-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | propan-2-yl 2-[4-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71955724 |
| Molecular Formula | C25H31NO6S |
| Molecular Weight | 473.59 g/mol |
| Exact Mass | 473.19 |
| IUPAC Name | propan-2-yl 2-[4-[[cyclobutanecarbonyl(propan-2-yl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CC(C)OC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(C(=O)C2CCC2)C(C)C)cc1 |
| InChI | InChI=1S/C25H31NO6S/c1-17(2)26(24(27)20-8-7-9-20)16-19-12-14-21(15-13-19)32-33(29,30)23-11-6-5-10-22(23)25(28)31-18(3)4/h5-6,10-15,17-18,20H,7-9,16H2,1-4H3 |
| InChIKey | PJLCRORXOLIKIN-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|