C24H30N2O2 — CID 109149711
4-N-benzyl-1-N-phenyl-4-N-propan-2-ylcyclohexane-1,4-dicarboxamide (PubChem CID 109149711) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is 4-N-benzyl-1-N-phenyl-4-N-propan-2-ylcyclohexane-1,4-dicarboxamide.
| Compound Name | 4-N-benzyl-1-N-phenyl-4-N-propan-2-ylcyclohexane-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109149711 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | 4-N-benzyl-1-N-phenyl-4-N-propan-2-ylcyclohexane-1,4-dicarboxamide |
| SMILES | CC(C)N(Cc1ccccc1)C(=O)C1CCC(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-18(2)26(17-19-9-5-3-6-10-19)24(28)21-15-13-20(14-16-21)23(27)25-22-11-7-4-8-12-22/h3-12,18,20-21H,13-17H2,1-2H3,(H,25,27) |
| InChIKey | KMDOMJYYABRWGQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |