C23H28N2O4 — CID 108503409
butyl 2-[[2-[benzyl(propan-2-yl)amino]-2-oxoacetyl]amino]benzoate (PubChem CID 108503409) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is butyl 2-[[2-[benzyl(propan-2-yl)amino]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[benzyl(propan-2-yl)amino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108503409 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | butyl 2-[[2-[benzyl(propan-2-yl)amino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)N(Cc1ccccc1)C(C)C |
| InChI | InChI=1S/C23H28N2O4/c1-4-5-15-29-23(28)19-13-9-10-14-20(19)24-21(26)22(27)25(17(2)3)16-18-11-7-6-8-12-18/h6-14,17H,4-5,15-16H2,1-3H3,(H,24,26) |
| InChIKey | DELZKFVEJJMKDD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|