C18H20N2O3S — CID 108886349
butyl 2-[(2-sulfanylphenyl)carbamoylamino]benzoate (PubChem CID 108886349) has the molecular formula C18H20N2O3S and a molecular weight of 344.44 g/mol. Its IUPAC name is butyl 2-[(2-sulfanylphenyl)carbamoylamino]benzoate.
| Compound Name | butyl 2-[(2-sulfanylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108886349 |
| Molecular Formula | C18H20N2O3S |
| Molecular Weight | 344.44 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | butyl 2-[(2-sulfanylphenyl)carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)Nc1ccccc1S |
| InChI | InChI=1S/C18H20N2O3S/c1-2-3-12-23-17(21)13-8-4-5-9-14(13)19-18(22)20-15-10-6-7-11-16(15)24/h4-11,24H,2-3,12H2,1H3,(H2,19,20,22) |
| InChIKey | AWDRQDKEHXPZDQ-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|