C22H23N3O3 — CID 108886698
butyl 2-[(4-pyrrol-1-ylphenyl)carbamoylamino]benzoate (PubChem CID 108886698) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is butyl 2-[(4-pyrrol-1-ylphenyl)carbamoylamino]benzoate.
| Compound Name | butyl 2-[(4-pyrrol-1-ylphenyl)carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108886698 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | butyl 2-[(4-pyrrol-1-ylphenyl)carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)Nc1ccc(-n2cccc2)cc1 |
| InChI | InChI=1S/C22H23N3O3/c1-2-3-16-28-21(26)19-8-4-5-9-20(19)24-22(27)23-17-10-12-18(13-11-17)25-14-6-7-15-25/h4-15H,2-3,16H2,1H3,(H2,23,24,27) |
| InChIKey | JDWZVBXTFUFBSW-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 72.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|