C19H21BrN2O3 — CID 108899421
butyl 2-[(4-bromophenyl)methylcarbamoylamino]benzoate (PubChem CID 108899421) has the molecular formula C19H21BrN2O3 and a molecular weight of 405.29 g/mol. Its IUPAC name is butyl 2-[(4-bromophenyl)methylcarbamoylamino]benzoate.
| Compound Name | butyl 2-[(4-bromophenyl)methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108899421 |
| Molecular Formula | C19H21BrN2O3 |
| Molecular Weight | 405.29 g/mol |
| Exact Mass | 404.07 |
| IUPAC Name | butyl 2-[(4-bromophenyl)methylcarbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)NCc1ccc(Br)cc1 |
| InChI | InChI=1S/C19H21BrN2O3/c1-2-3-12-25-18(23)16-6-4-5-7-17(16)22-19(24)21-13-14-8-10-15(20)11-9-14/h4-11H,2-3,12-13H2,1H3,(H2,21,22,24) |
| InChIKey | JXHAGJBAZJQIJI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.29 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|