C21H25ClN2O4 — CID 108883426
butyl 2-[3-(2-chlorophenoxy)propylcarbamoylamino]benzoate (PubChem CID 108883426) has the molecular formula C21H25ClN2O4 and a molecular weight of 404.89 g/mol. Its IUPAC name is butyl 2-[3-(2-chlorophenoxy)propylcarbamoylamino]benzoate.
| Compound Name | butyl 2-[3-(2-chlorophenoxy)propylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108883426 |
| Molecular Formula | C21H25ClN2O4 |
| Molecular Weight | 404.89 g/mol |
| Exact Mass | 404.15 |
| IUPAC Name | butyl 2-[3-(2-chlorophenoxy)propylcarbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)NCCCOc1ccccc1Cl |
| InChI | InChI=1S/C21H25ClN2O4/c1-2-3-14-28-20(25)16-9-4-6-11-18(16)24-21(26)23-13-8-15-27-19-12-7-5-10-17(19)22/h4-7,9-12H,2-3,8,13-15H2,1H3,(H2,23,24,26) |
| InChIKey | PQUCHOGFKGRHHR-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.89 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|