C20H21ClN2O3 — CID 108904666
butyl 2-[[(E)-2-(2-chlorophenyl)ethenyl]carbamoylamino]benzoate (PubChem CID 108904666) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is butyl 2-[[(E)-2-(2-chlorophenyl)ethenyl]carbamoylamino]benzoate.
| Compound Name | butyl 2-[[(E)-2-(2-chlorophenyl)ethenyl]carbamoylamino]benzoate |
|---|---|
| PubChem CID | 108904666 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | butyl 2-[[(E)-2-(2-chlorophenyl)ethenyl]carbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)N/C=C/c1ccccc1Cl |
| InChI | InChI=1S/C20H21ClN2O3/c1-2-3-14-26-19(24)16-9-5-7-11-18(16)23-20(25)22-13-12-15-8-4-6-10-17(15)21/h4-13H,2-3,14H2,1H3,(H2,22,23,25)/b13-12+ |
| InChIKey | OKVAGVVECOYVMZ-OUKQBFOZSA-N |
| XLogP | 5.09 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|