C18H18ClN3O4 — CID 108514570
butyl 2-[[2-[(2-chloro-3-pyridinyl)amino]-2-oxoacetyl]amino]benzoate (PubChem CID 108514570) has the molecular formula C18H18ClN3O4 and a molecular weight of 375.81 g/mol. Its IUPAC name is butyl 2-[[2-[(2-chloro-3-pyridinyl)amino]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[(2-chloro-3-pyridinyl)amino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108514570 |
| Molecular Formula | C18H18ClN3O4 |
| Molecular Weight | 375.81 g/mol |
| Exact Mass | 375.10 |
| IUPAC Name | butyl 2-[[2-[(2-chloro-3-pyridinyl)amino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C18H18ClN3O4/c1-2-3-11-26-18(25)12-7-4-5-8-13(12)21-16(23)17(24)22-14-9-6-10-20-15(14)19/h4-10H,2-3,11H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | WHOUTXPOHVAMKU-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.81 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|