C20H21N3O5 — CID 108514644
butyl 2-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate (PubChem CID 108514644) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is butyl 2-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate.
| Compound Name | butyl 2-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate |
|---|---|
| PubChem CID | 108514644 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | butyl 2-[[2-[(4-aminobenzoyl)amino]-2-oxoacetyl]amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)C(=O)NC(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-2-3-12-28-20(27)15-6-4-5-7-16(15)22-18(25)19(26)23-17(24)13-8-10-14(21)11-9-13/h4-11H,2-3,12,21H2,1H3,(H,22,25)(H,23,24,26) |
| InChIKey | QWQIWSSRXWVHBU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 127.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|