C20H21NO5 — CID 108786656
butyl 2-[(3-methoxycarbonylbenzoyl)amino]benzoate (PubChem CID 108786656) has the molecular formula C20H21NO5 and a molecular weight of 355.39 g/mol. Its IUPAC name is butyl 2-[(3-methoxycarbonylbenzoyl)amino]benzoate.
| Compound Name | butyl 2-[(3-methoxycarbonylbenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 108786656 |
| Molecular Formula | C20H21NO5 |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 355.14 |
| IUPAC Name | butyl 2-[(3-methoxycarbonylbenzoyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1cccc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H21NO5/c1-3-4-12-26-20(24)16-10-5-6-11-17(16)21-18(22)14-8-7-9-15(13-14)19(23)25-2/h5-11,13H,3-4,12H2,1-2H3,(H,21,22) |
| InChIKey | WOUAVAUXZYKGSM-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|