C25H23N3O3 — CID 108788473
butyl 2-[(2-phenylimidazo[1,2-a]pyridine-7-carbonyl)amino]benzoate (PubChem CID 108788473) has the molecular formula C25H23N3O3 and a molecular weight of 413.48 g/mol. Its IUPAC name is butyl 2-[(2-phenylimidazo[1,2-a]pyridine-7-carbonyl)amino]benzoate.
| Compound Name | butyl 2-[(2-phenylimidazo[1,2-a]pyridine-7-carbonyl)amino]benzoate |
|---|---|
| PubChem CID | 108788473 |
| Molecular Formula | C25H23N3O3 |
| Molecular Weight | 413.48 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | butyl 2-[(2-phenylimidazo[1,2-a]pyridine-7-carbonyl)amino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)c1ccn2cc(-c3ccccc3)nc2c1 |
| InChI | InChI=1S/C25H23N3O3/c1-2-3-15-31-25(30)20-11-7-8-12-21(20)27-24(29)19-13-14-28-17-22(26-23(28)16-19)18-9-5-4-6-10-18/h4-14,16-17H,2-3,15H2,1H3,(H,27,29) |
| InChIKey | PQRQCYLLDMHHRX-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.48 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|