C20H23NO4 — CID 4935100
methyl 2-[(4-pentoxybenzoyl)amino]benzoate (PubChem CID 4935100) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 2-[(4-pentoxybenzoyl)amino]benzoate.
| Compound Name | methyl 2-[(4-pentoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 4935100 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | methyl 2-[(4-pentoxybenzoyl)amino]benzoate |
| SMILES | CCCCCOc1ccc(C(=O)Nc2ccccc2C(=O)OC)cc1 |
| InChI | InChI=1S/C20H23NO4/c1-3-4-7-14-25-16-12-10-15(11-13-16)19(22)21-18-9-6-5-8-17(18)20(23)24-2/h5-6,8-13H,3-4,7,14H2,1-2H3,(H,21,22) |
| InChIKey | CFBRJEBPHXGFHW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|