C22H27NO4 — CID 19170768
ethyl 2-[(4-hexoxybenzoyl)amino]benzoate (PubChem CID 19170768) has the molecular formula C22H27NO4 and a molecular weight of 369.46 g/mol. Its IUPAC name is ethyl 2-[(4-hexoxybenzoyl)amino]benzoate.
| Compound Name | ethyl 2-[(4-hexoxybenzoyl)amino]benzoate |
|---|---|
| PubChem CID | 19170768 |
| Molecular Formula | C22H27NO4 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | ethyl 2-[(4-hexoxybenzoyl)amino]benzoate |
| SMILES | CCCCCCOc1ccc(C(=O)Nc2ccccc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C22H27NO4/c1-3-5-6-9-16-27-18-14-12-17(13-15-18)21(24)23-20-11-8-7-10-19(20)22(25)26-4-2/h7-8,10-15H,3-6,9,16H2,1-2H3,(H,23,24) |
| InChIKey | DQEYHUCPWKMAEQ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|