C16H15ClN2O5S — CID 8856113
[2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-ethylsulfonylbenzoate (PubChem CID 8856113) has the molecular formula C16H15ClN2O5S and a molecular weight of 382.83 g/mol. Its IUPAC name is [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-ethylsulfonylbenzoate.
| Compound Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-ethylsulfonylbenzoate |
|---|---|
| PubChem CID | 8856113 |
| Molecular Formula | C16H15ClN2O5S |
| Molecular Weight | 382.83 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | [2-[(2-chloro-3-pyridinyl)amino]-2-oxoethyl] 2-ethylsulfonylbenzoate |
| SMILES | CCS(=O)(=O)c1ccccc1C(=O)OCC(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C16H15ClN2O5S/c1-2-25(22,23)13-8-4-3-6-11(13)16(21)24-10-14(20)19-12-7-5-9-18-15(12)17/h3-9H,2,10H2,1H3,(H,19,20) |
| InChIKey | DIVKVJRNLHEVCS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 102.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.83 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|