C21H26N2O4 — CID 3250064
butyl 2-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate (PubChem CID 3250064) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is butyl 2-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate.
| Compound Name | butyl 2-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 3250064 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | butyl 2-[2-(3-methoxyphenyl)ethylcarbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)NCCc1cccc(OC)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-3-4-14-27-20(24)18-10-5-6-11-19(18)23-21(25)22-13-12-16-8-7-9-17(15-16)26-2/h5-11,15H,3-4,12-14H2,1-2H3,(H2,22,23,25) |
| InChIKey | DNOWLPDFMICSDF-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|