C20H24N2O5 — CID 108871020
butyl 2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]benzoate (PubChem CID 108871020) has the molecular formula C20H24N2O5 and a molecular weight of 372.42 g/mol. Its IUPAC name is butyl 2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]benzoate.
| Compound Name | butyl 2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 108871020 |
| Molecular Formula | C20H24N2O5 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.17 |
| IUPAC Name | butyl 2-[1-(4-hydroxyphenoxy)ethylcarbamoylamino]benzoate |
| SMILES | CCCCOC(=O)c1ccccc1NC(=O)NC(C)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C20H24N2O5/c1-3-4-13-26-19(24)17-7-5-6-8-18(17)22-20(25)21-14(2)27-16-11-9-15(23)10-12-16/h5-12,14,23H,3-4,13H2,1-2H3,(H2,21,22,25) |
| InChIKey | YEXYCHSJJIZIQU-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 96.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|