C30H32ClNO7S — CID 71955232
butyl 2-[4-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71955232) has the molecular formula C30H32ClNO7S and a molecular weight of 586.11 g/mol. Its IUPAC name is butyl 2-[4-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | butyl 2-[4-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71955232 |
| Molecular Formula | C30H32ClNO7S |
| Molecular Weight | 586.11 g/mol |
| Exact Mass | 585.16 |
| IUPAC Name | butyl 2-[4-[[(2-chlorobenzoyl)-(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CCCCOC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(CC2CCCO2)C(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C30H32ClNO7S/c1-2-3-18-38-30(34)26-11-5-7-13-28(26)40(35,36)39-23-16-14-22(15-17-23)20-32(21-24-9-8-19-37-24)29(33)25-10-4-6-12-27(25)31/h4-7,10-17,24H,2-3,8-9,18-21H2,1H3 |
| InChIKey | SQWWPWFHQMXJMV-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.11 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|