C23H31N3O7S2 — CID 71955012
[4-[[ethylcarbamoyl(oxolan-2-ylmethyl)amino]methyl]phenyl] 2-(dimethylsulfamoyl)benzenesulfonate (PubChem CID 71955012) has the molecular formula C23H31N3O7S2 and a molecular weight of 525.65 g/mol. Its IUPAC name is [4-[[ethylcarbamoyl(oxolan-2-ylmethyl)amino]methyl]phenyl] 2-(dimethylsulfamoyl)benzenesulfonate.
| Compound Name | [4-[[ethylcarbamoyl(oxolan-2-ylmethyl)amino]methyl]phenyl] 2-(dimethylsulfamoyl)benzenesulfonate |
|---|---|
| PubChem CID | 71955012 |
| Molecular Formula | C23H31N3O7S2 |
| Molecular Weight | 525.65 g/mol |
| Exact Mass | 525.16 |
| IUPAC Name | [4-[[ethylcarbamoyl(oxolan-2-ylmethyl)amino]methyl]phenyl] 2-(dimethylsulfamoyl)benzenesulfonate |
| SMILES | CCNC(=O)N(Cc1ccc(OS(=O)(=O)c2ccccc2S(=O)(=O)N(C)C)cc1)CC1CCCO1 |
| InChI | InChI=1S/C23H31N3O7S2/c1-4-24-23(27)26(17-20-8-7-15-32-20)16-18-11-13-19(14-12-18)33-35(30,31)22-10-6-5-9-21(22)34(28,29)25(2)3/h5-6,9-14,20H,4,7-8,15-17H2,1-3H3,(H,24,27) |
| InChIKey | HIBGJLSMTDEQIG-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 122.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.65 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|