C28H31NO8S — CID 71955248
butyl 2-[4-[[furan-2-carbonyl(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate (PubChem CID 71955248) has the molecular formula C28H31NO8S and a molecular weight of 541.62 g/mol. Its IUPAC name is butyl 2-[4-[[furan-2-carbonyl(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate.
| Compound Name | butyl 2-[4-[[furan-2-carbonyl(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
|---|---|
| PubChem CID | 71955248 |
| Molecular Formula | C28H31NO8S |
| Molecular Weight | 541.62 g/mol |
| Exact Mass | 541.18 |
| IUPAC Name | butyl 2-[4-[[furan-2-carbonyl(oxolan-2-ylmethyl)amino]methyl]phenoxy]sulfonylbenzoate |
| SMILES | CCCCOC(=O)c1ccccc1S(=O)(=O)Oc1ccc(CN(CC2CCCO2)C(=O)c2ccco2)cc1 |
| InChI | InChI=1S/C28H31NO8S/c1-2-3-16-36-28(31)24-9-4-5-11-26(24)38(32,33)37-22-14-12-21(13-15-22)19-29(20-23-8-6-17-34-23)27(30)25-10-7-18-35-25/h4-5,7,9-15,18,23H,2-3,6,8,16-17,19-20H2,1H3 |
| InChIKey | MERLOUHORISHRM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 112.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.62 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|