C23H28ClNO3 — CID 19118857
2-butoxy-N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 19118857) has the molecular formula C23H28ClNO3 and a molecular weight of 401.93 g/mol. Its IUPAC name is 2-butoxy-N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-butoxy-N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 19118857 |
| Molecular Formula | C23H28ClNO3 |
| Molecular Weight | 401.93 g/mol |
| Exact Mass | 401.18 |
| IUPAC Name | 2-butoxy-N-[(4-chlorophenyl)methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CCCCOc1ccccc1C(=O)N(Cc1ccc(Cl)cc1)CC1CCCO1 |
| InChI | InChI=1S/C23H28ClNO3/c1-2-3-14-28-22-9-5-4-8-21(22)23(26)25(17-20-7-6-15-27-20)16-18-10-12-19(24)13-11-18/h4-5,8-13,20H,2-3,6-7,14-17H2,1H3 |
| InChIKey | CHZRYRASTSIRJI-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.93 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|