C21H22ClNO2 — CID 40850268
(E)-N-[(4-chlorophenyl)methyl]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 40850268) has the molecular formula C21H22ClNO2 and a molecular weight of 355.87 g/mol. Its IUPAC name is (E)-N-[(4-chlorophenyl)methyl]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(4-chlorophenyl)methyl]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 40850268 |
| Molecular Formula | C21H22ClNO2 |
| Molecular Weight | 355.87 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | (E)-N-[(4-chlorophenyl)methyl]-N-[[(2S)-oxolan-2-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N(Cc1ccc(Cl)cc1)C[C@@H]1CCCO1 |
| InChI | InChI=1S/C21H22ClNO2/c22-19-11-8-18(9-12-19)15-23(16-20-7-4-14-25-20)21(24)13-10-17-5-2-1-3-6-17/h1-3,5-6,8-13,20H,4,7,14-16H2/b13-10+/t20-/m0/s1 |
| InChIKey | JJMCYDPTGHGVAG-YPNIWSFNSA-N |
| XLogP | 4.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.87 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|