C29H32N2O3S — CID 3980575
N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide (PubChem CID 3980575) has the molecular formula C29H32N2O3S and a molecular weight of 488.65 g/mol. Its IUPAC name is N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide.
| Compound Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 3980575 |
| Molecular Formula | C29H32N2O3S |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.21 |
| IUPAC Name | N-[2-[benzyl-[(3-methylthiophen-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)-3-phenylprop-2-enamide |
| SMILES | Cc1ccsc1CN(Cc1ccccc1)C(=O)CN(CC1CCCO1)C(=O)C=Cc1ccccc1 |
| InChI | InChI=1S/C29H32N2O3S/c1-23-16-18-35-27(23)21-30(19-25-11-6-3-7-12-25)29(33)22-31(20-26-13-8-17-34-26)28(32)15-14-24-9-4-2-5-10-24/h2-7,9-12,14-16,18,26H,8,13,17,19-22H2,1H3 |
| InChIKey | UGVHOYVTNKSSMC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|