C25H35N3O3S — CID 5034344
N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide (PubChem CID 5034344) has the molecular formula C25H35N3O3S and a molecular weight of 457.64 g/mol. Its IUPAC name is N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 5034344 |
| Molecular Formula | C25H35N3O3S |
| Molecular Weight | 457.64 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-benzyl-2-[butylcarbamoyl(oxolan-2-ylmethyl)amino]-N-[(3-methylthiophen-2-yl)methyl]acetamide |
| SMILES | CCCCNC(=O)N(CC(=O)N(Cc1ccccc1)Cc1sccc1C)CC1CCCO1 |
| InChI | InChI=1S/C25H35N3O3S/c1-3-4-13-26-25(30)28(17-22-11-8-14-31-22)19-24(29)27(16-21-9-6-5-7-10-21)18-23-20(2)12-15-32-23/h5-7,9-10,12,15,22H,3-4,8,11,13-14,16-19H2,1-2H3,(H,26,30) |
| InChIKey | LACPPAAFFYHPBE-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.64 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|