C21H21ClFNO2 — CID 40851049
(E)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide (PubChem CID 40851049) has the molecular formula C21H21ClFNO2 and a molecular weight of 373.86 g/mol. Its IUPAC name is (E)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide.
| Compound Name | (E)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 40851049 |
| Molecular Formula | C21H21ClFNO2 |
| Molecular Weight | 373.86 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | (E)-N-[(4-chlorophenyl)methyl]-3-(4-fluorophenyl)-N-[[(2R)-oxolan-2-yl]methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(F)cc1)N(Cc1ccc(Cl)cc1)C[C@H]1CCCO1 |
| InChI | InChI=1S/C21H21ClFNO2/c22-18-8-3-17(4-9-18)14-24(15-20-2-1-13-26-20)21(25)12-7-16-5-10-19(23)11-6-16/h3-12,20H,1-2,13-15H2/b12-7+/t20-/m1/s1 |
| InChIKey | FSYCFIOGPCDHBK-ACGJQVIASA-N |
| XLogP | 4.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.86 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|