C16H18FNO4 — CID 71915579
2-[3-(4-fluorophenyl)prop-2-enoyl-(oxolan-2-ylmethyl)amino]acetic acid (PubChem CID 71915579) has the molecular formula C16H18FNO4 and a molecular weight of 307.32 g/mol. Its IUPAC name is 2-[3-(4-fluorophenyl)prop-2-enoyl-(oxolan-2-ylmethyl)amino]acetic acid.
| Compound Name | 2-[3-(4-fluorophenyl)prop-2-enoyl-(oxolan-2-ylmethyl)amino]acetic acid |
|---|---|
| PubChem CID | 71915579 |
| Molecular Formula | C16H18FNO4 |
| Molecular Weight | 307.32 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-[3-(4-fluorophenyl)prop-2-enoyl-(oxolan-2-ylmethyl)amino]acetic acid |
| SMILES | O=C(O)CN(CC1CCCO1)C(=O)C=Cc1ccc(F)cc1 |
| InChI | InChI=1S/C16H18FNO4/c17-13-6-3-12(4-7-13)5-8-15(19)18(11-16(20)21)10-14-2-1-9-22-14/h3-8,14H,1-2,9-11H2,(H,20,21) |
| InChIKey | BYDGXPDQWNDJDL-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.32 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|