C18H25NO2 — CID 3352945
3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-propylprop-2-enamide (PubChem CID 3352945) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-propylprop-2-enamide.
| Compound Name | 3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-propylprop-2-enamide |
|---|---|
| PubChem CID | 3352945 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 3-(4-methylphenyl)-N-(oxolan-2-ylmethyl)-N-propylprop-2-enamide |
| SMILES | CCCN(CC1CCCO1)C(=O)C=Cc1ccc(C)cc1 |
| InChI | InChI=1S/C18H25NO2/c1-3-12-19(14-17-5-4-13-21-17)18(20)11-10-16-8-6-15(2)7-9-16/h6-11,17H,3-5,12-14H2,1-2H3 |
| InChIKey | HQHGYRGLBBDPPL-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|