C28H28FN3O6 — CID 6023663
(E)-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 6023663) has the molecular formula C28H28FN3O6 and a molecular weight of 521.55 g/mol. Its IUPAC name is (E)-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 6023663 |
| Molecular Formula | C28H28FN3O6 |
| Molecular Weight | 521.55 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | (E)-N-[2-[(4-fluorophenyl)methyl-(furan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc([N+](=O)[O-])cc1)N(CC(=O)N(Cc1ccc(F)cc1)Cc1ccco1)CC1CCCO1 |
| InChI | InChI=1S/C28H28FN3O6/c29-23-10-5-22(6-11-23)17-30(18-25-3-1-15-37-25)28(34)20-31(19-26-4-2-16-38-26)27(33)14-9-21-7-12-24(13-8-21)32(35)36/h1,3,5-15,26H,2,4,16-20H2/b14-9+ |
| InChIKey | VUQCMAQUGDCMRB-NTEUORMPSA-N |
| XLogP | 4.58 |
| TPSA | 106.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.55 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|