C24H29N3O6 — CID 3638963
N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-propan-2-ylprop-2-enamide (PubChem CID 3638963) has the molecular formula C24H29N3O6 and a molecular weight of 455.51 g/mol. Its IUPAC name is N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-propan-2-ylprop-2-enamide.
| Compound Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-propan-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 3638963 |
| Molecular Formula | C24H29N3O6 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | N-[2-[furan-2-ylmethyl(oxolan-2-ylmethyl)amino]-2-oxoethyl]-3-(4-nitrophenyl)-N-propan-2-ylprop-2-enamide |
| SMILES | CC(C)N(CC(=O)N(Cc1ccco1)CC1CCCO1)C(=O)C=Cc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H29N3O6/c1-18(2)26(23(28)12-9-19-7-10-20(11-8-19)27(30)31)17-24(29)25(15-21-5-3-13-32-21)16-22-6-4-14-33-22/h3,5,7-13,18,22H,4,6,14-17H2,1-2H3 |
| InChIKey | HGJVVABQUMUZMT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 106.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|