C21H26N4O9S — CID 4202373
2-[(2,4-dinitrophenyl)sulfonyl-propan-2-ylamino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 4202373) has the molecular formula C21H26N4O9S and a molecular weight of 510.53 g/mol. Its IUPAC name is 2-[(2,4-dinitrophenyl)sulfonyl-propan-2-ylamino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(2,4-dinitrophenyl)sulfonyl-propan-2-ylamino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 4202373 |
| Molecular Formula | C21H26N4O9S |
| Molecular Weight | 510.53 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | 2-[(2,4-dinitrophenyl)sulfonyl-propan-2-ylamino]-N-(furan-2-ylmethyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | CC(C)N(CC(=O)N(Cc1ccco1)CC1CCCO1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H26N4O9S/c1-15(2)23(35(31,32)20-8-7-16(24(27)28)11-19(20)25(29)30)14-21(26)22(12-17-5-3-9-33-17)13-18-6-4-10-34-18/h3,5,7-9,11,15,18H,4,6,10,12-14H2,1-2H3 |
| InChIKey | ZPBSDKYUKJLRSS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 166.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|