C26H27N3O9S — CID 4689797
N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide (PubChem CID 4689797) has the molecular formula C26H27N3O9S and a molecular weight of 557.58 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide |
|---|---|
| PubChem CID | 4689797 |
| Molecular Formula | C26H27N3O9S |
| Molecular Weight | 557.58 g/mol |
| Exact Mass | 557.15 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[(4-nitrophenyl)sulfonyl-(oxolan-2-ylmethyl)amino]acetamide |
| SMILES | O=C(CN(CC1CCCO1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)N(Cc1ccc2c(c1)OCO2)Cc1ccco1 |
| InChI | InChI=1S/C26H27N3O9S/c30-26(27(15-21-3-1-11-35-21)14-19-5-10-24-25(13-19)38-18-37-24)17-28(16-22-4-2-12-36-22)39(33,34)23-8-6-20(7-9-23)29(31)32/h1,3,5-11,13,22H,2,4,12,14-18H2 |
| InChIKey | RMLHOYRAUWMRFS-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 141.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|