C28H32N4O9S — CID 4585823
N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[3-morpholin-4-ylpropyl-(4-nitrophenyl)sulfonylamino]acetamide (PubChem CID 4585823) has the molecular formula C28H32N4O9S and a molecular weight of 600.65 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[3-morpholin-4-ylpropyl-(4-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[3-morpholin-4-ylpropyl-(4-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4585823 |
| Molecular Formula | C28H32N4O9S |
| Molecular Weight | 600.65 g/mol |
| Exact Mass | 600.19 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-(furan-2-ylmethyl)-2-[3-morpholin-4-ylpropyl-(4-nitrophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CN(CCCN1CCOCC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)N(Cc1ccc2c(c1)OCO2)Cc1ccco1 |
| InChI | InChI=1S/C28H32N4O9S/c33-28(30(19-24-3-1-14-39-24)18-22-4-9-26-27(17-22)41-21-40-26)20-31(11-2-10-29-12-15-38-16-13-29)42(36,37)25-7-5-23(6-8-25)32(34)35/h1,3-9,14,17H,2,10-13,15-16,18-21H2 |
| InChIKey | FTSKXGIOEULKMW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 144.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.65 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|