C26H29FN4O7S — CID 4103052
N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl-(4-nitrophenyl)sulfonylamino]acetamide (PubChem CID 4103052) has the molecular formula C26H29FN4O7S and a molecular weight of 560.60 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl-(4-nitrophenyl)sulfonylamino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl-(4-nitrophenyl)sulfonylamino]acetamide |
|---|---|
| PubChem CID | 4103052 |
| Molecular Formula | C26H29FN4O7S |
| Molecular Weight | 560.60 g/mol |
| Exact Mass | 560.17 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-(furan-2-ylmethyl)-2-[2-morpholin-4-ylethyl-(4-nitrophenyl)sulfonylamino]acetamide |
| SMILES | O=C(CN(CCN1CCOCC1)S(=O)(=O)c1ccc([N+](=O)[O-])cc1)N(Cc1ccc(F)cc1)Cc1ccco1 |
| InChI | InChI=1S/C26H29FN4O7S/c27-22-5-3-21(4-6-22)18-29(19-24-2-1-15-38-24)26(32)20-30(12-11-28-13-16-37-17-14-28)39(35,36)25-9-7-23(8-10-25)31(33)34/h1-10,15H,11-14,16-20H2 |
| InChIKey | MYTQBGGONYAVRA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 126.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.60 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|