C28H32FN5O6 — CID 5244602
N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[2-morpholin-4-ylethyl-[(4-nitrophenyl)carbamoyl]amino]acetamide (PubChem CID 5244602) has the molecular formula C28H32FN5O6 and a molecular weight of 553.59 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[2-morpholin-4-ylethyl-[(4-nitrophenyl)carbamoyl]amino]acetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[2-morpholin-4-ylethyl-[(4-nitrophenyl)carbamoyl]amino]acetamide |
|---|---|
| PubChem CID | 5244602 |
| Molecular Formula | C28H32FN5O6 |
| Molecular Weight | 553.59 g/mol |
| Exact Mass | 553.23 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-N-[(5-methylfuran-2-yl)methyl]-2-[2-morpholin-4-ylethyl-[(4-nitrophenyl)carbamoyl]amino]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccc(F)cc2)C(=O)CN(CCN2CCOCC2)C(=O)Nc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C28H32FN5O6/c1-21-2-11-26(40-21)19-33(18-22-3-5-23(29)6-4-22)27(35)20-32(13-12-31-14-16-39-17-15-31)28(36)30-24-7-9-25(10-8-24)34(37)38/h2-11H,12-20H2,1H3,(H,30,36) |
| InChIKey | HSPKFMINKATGNX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 121.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.59 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|