C25H28N4O6 — CID 3274981
N-benzyl-2-[2-methoxyethyl-[(4-nitrophenyl)carbamoyl]amino]-N-[(5-methylfuran-2-yl)methyl]acetamide (PubChem CID 3274981) has the molecular formula C25H28N4O6 and a molecular weight of 480.52 g/mol. Its IUPAC name is N-benzyl-2-[2-methoxyethyl-[(4-nitrophenyl)carbamoyl]amino]-N-[(5-methylfuran-2-yl)methyl]acetamide.
| Compound Name | N-benzyl-2-[2-methoxyethyl-[(4-nitrophenyl)carbamoyl]amino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
|---|---|
| PubChem CID | 3274981 |
| Molecular Formula | C25H28N4O6 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.20 |
| IUPAC Name | N-benzyl-2-[2-methoxyethyl-[(4-nitrophenyl)carbamoyl]amino]-N-[(5-methylfuran-2-yl)methyl]acetamide |
| SMILES | COCCN(CC(=O)N(Cc1ccccc1)Cc1ccc(C)o1)C(=O)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H28N4O6/c1-19-8-13-23(35-19)17-28(16-20-6-4-3-5-7-20)24(30)18-27(14-15-34-2)25(31)26-21-9-11-22(12-10-21)29(32)33/h3-13H,14-18H2,1-2H3,(H,26,31) |
| InChIKey | XPEUCJIEYDVLEF-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|