C27H30N4O6 — CID 93109942
N-benzyl-N-[(5-methylfuran-2-yl)methyl]-2-[(4-nitrophenyl)carbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]acetamide (PubChem CID 93109942) has the molecular formula C27H30N4O6 and a molecular weight of 506.56 g/mol. Its IUPAC name is N-benzyl-N-[(5-methylfuran-2-yl)methyl]-2-[(4-nitrophenyl)carbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]acetamide.
| Compound Name | N-benzyl-N-[(5-methylfuran-2-yl)methyl]-2-[(4-nitrophenyl)carbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]acetamide |
|---|---|
| PubChem CID | 93109942 |
| Molecular Formula | C27H30N4O6 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | N-benzyl-N-[(5-methylfuran-2-yl)methyl]-2-[(4-nitrophenyl)carbamoyl-[[(2R)-oxolan-2-yl]methyl]amino]acetamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(C[C@H]2CCCO2)C(=O)Nc2ccc([N+](=O)[O-])cc2)o1 |
| InChI | InChI=1S/C27H30N4O6/c1-20-9-14-25(37-20)18-29(16-21-6-3-2-4-7-21)26(32)19-30(17-24-8-5-15-36-24)27(33)28-22-10-12-23(13-11-22)31(34)35/h2-4,6-7,9-14,24H,5,8,15-19H2,1H3,(H,28,33)/t24-/m1/s1 |
| InChIKey | XCDHXFZWSIXTTR-XMMPIXPASA-N |
| XLogP | 4.74 |
| TPSA | 118.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|