C27H30N2O4 — CID 5052075
N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 5052075) has the molecular formula C27H30N2O4 and a molecular weight of 446.55 g/mol. Its IUPAC name is N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 5052075 |
| Molecular Formula | C27H30N2O4 |
| Molecular Weight | 446.55 g/mol |
| Exact Mass | 446.22 |
| IUPAC Name | N-[2-[benzyl-[(5-methylfuran-2-yl)methyl]amino]-2-oxoethyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | Cc1ccc(CN(Cc2ccccc2)C(=O)CN(CC2CCCO2)C(=O)c2ccccc2)o1 |
| InChI | InChI=1S/C27H30N2O4/c1-21-14-15-25(33-21)19-28(17-22-9-4-2-5-10-22)26(30)20-29(18-24-13-8-16-32-24)27(31)23-11-6-3-7-12-23/h2-7,9-12,14-15,24H,8,13,16-20H2,1H3 |
| InChIKey | RNLMZSRCRAUJPJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 62.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.55 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |